C14H17N3O3 — CID 106136485
4-(4-hydroxypentylamino)quinazoline-2-carboxylic acid (PubChem CID 106136485) has the molecular formula C14H17N3O3 and a molecular weight of 275.31 g/mol. Its IUPAC name is 4-(4-hydroxypentylamino)quinazoline-2-carboxylic acid.
| Compound Name | 4-(4-hydroxypentylamino)quinazoline-2-carboxylic acid |
|---|---|
| PubChem CID | 106136485 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 4-(4-hydroxypentylamino)quinazoline-2-carboxylic acid |
| SMILES | CC(O)CCCNc1nc(C(=O)O)nc2ccccc12 |
| InChI | InChI=1S/C14H17N3O3/c1-9(18)5-4-8-15-12-10-6-2-3-7-11(10)16-13(17-12)14(19)20/h2-3,6-7,9,18H,4-5,8H2,1H3,(H,19,20)(H,15,16,17) |
| InChIKey | UJDCVQBFMWMKDC-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|