C11H12N4O2 — CID 83016198
4-(2,2-dimethylhydrazinyl)quinazoline-2-carboxylic acid (PubChem CID 83016198) has the molecular formula C11H12N4O2 and a molecular weight of 232.24 g/mol. Its IUPAC name is 4-(2,2-dimethylhydrazinyl)quinazoline-2-carboxylic acid.
| Compound Name | 4-(2,2-dimethylhydrazinyl)quinazoline-2-carboxylic acid |
|---|---|
| PubChem CID | 83016198 |
| Molecular Formula | C11H12N4O2 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | 4-(2,2-dimethylhydrazinyl)quinazoline-2-carboxylic acid |
| SMILES | CN(C)Nc1nc(C(=O)O)nc2ccccc12 |
| InChI | InChI=1S/C11H12N4O2/c1-15(2)14-9-7-5-3-4-6-8(7)12-10(13-9)11(16)17/h3-6H,1-2H3,(H,16,17)(H,12,13,14) |
| InChIKey | SMKOQDBHNLFTKL-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|