C14H20N4 — CID 80831388
4-N-(4-methylpentyl)quinazoline-2,4-diamine (PubChem CID 80831388) has the molecular formula C14H20N4 and a molecular weight of 244.34 g/mol. Its IUPAC name is 4-N-(4-methylpentyl)quinazoline-2,4-diamine.
| Compound Name | 4-N-(4-methylpentyl)quinazoline-2,4-diamine |
|---|---|
| PubChem CID | 80831388 |
| Molecular Formula | C14H20N4 |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | 4-N-(4-methylpentyl)quinazoline-2,4-diamine |
| SMILES | CC(C)CCCNc1nc(N)nc2ccccc12 |
| InChI | InChI=1S/C14H20N4/c1-10(2)6-5-9-16-13-11-7-3-4-8-12(11)17-14(15)18-13/h3-4,7-8,10H,5-6,9H2,1-2H3,(H3,15,16,17,18) |
| InChIKey | QDAAYIBHNKVJPR-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|