C18H27N3 — CID 107816078
3-methyl-N-(7-methyloctyl)quinoxalin-2-amine (PubChem CID 107816078) has the molecular formula C18H27N3 and a molecular weight of 285.43 g/mol. Its IUPAC name is 3-methyl-N-(7-methyloctyl)quinoxalin-2-amine.
| Compound Name | 3-methyl-N-(7-methyloctyl)quinoxalin-2-amine |
|---|---|
| PubChem CID | 107816078 |
| Molecular Formula | C18H27N3 |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.22 |
| IUPAC Name | 3-methyl-N-(7-methyloctyl)quinoxalin-2-amine |
| SMILES | Cc1nc2ccccc2nc1NCCCCCCC(C)C |
| InChI | InChI=1S/C18H27N3/c1-14(2)10-6-4-5-9-13-19-18-15(3)20-16-11-7-8-12-17(16)21-18/h7-8,11-12,14H,4-6,9-10,13H2,1-3H3,(H,19,21) |
| InChIKey | VPVICASHJCLMDJ-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|