C17H20N4O — CID 133347501
N-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]-3-methylquinoxalin-2-amine (PubChem CID 133347501) has the molecular formula C17H20N4O and a molecular weight of 296.37 g/mol. Its IUPAC name is N-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]-3-methylquinoxalin-2-amine.
| Compound Name | N-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]-3-methylquinoxalin-2-amine |
|---|---|
| PubChem CID | 133347501 |
| Molecular Formula | C17H20N4O |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | N-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]-3-methylquinoxalin-2-amine |
| SMILES | Cc1nc2ccccc2nc1NCCCc1c(C)noc1C |
| InChI | InChI=1S/C17H20N4O/c1-11-14(13(3)22-21-11)7-6-10-18-17-12(2)19-15-8-4-5-9-16(15)20-17/h4-5,8-9H,6-7,10H2,1-3H3,(H,18,20) |
| InChIKey | SSIAFIICVNYOTN-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|