C14H15N3 — CID 103704423
3-methyl-N-pent-4-ynylquinoxalin-2-amine (PubChem CID 103704423) has the molecular formula C14H15N3 and a molecular weight of 225.29 g/mol. Its IUPAC name is 3-methyl-N-pent-4-ynylquinoxalin-2-amine.
| Compound Name | 3-methyl-N-pent-4-ynylquinoxalin-2-amine |
|---|---|
| PubChem CID | 103704423 |
| Molecular Formula | C14H15N3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | 3-methyl-N-pent-4-ynylquinoxalin-2-amine |
| SMILES | C#CCCCNc1nc2ccccc2nc1C |
| InChI | InChI=1S/C14H15N3/c1-3-4-7-10-15-14-11(2)16-12-8-5-6-9-13(12)17-14/h1,5-6,8-9H,4,7,10H2,2H3,(H,15,17) |
| InChIKey | PDHXFOPWDMTMMF-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|