C13H16ClN3 — CID 106845037
N-(4-chlorobutyl)-3-methylquinoxalin-2-amine (PubChem CID 106845037) has the molecular formula C13H16ClN3 and a molecular weight of 249.75 g/mol. Its IUPAC name is N-(4-chlorobutyl)-3-methylquinoxalin-2-amine.
| Compound Name | N-(4-chlorobutyl)-3-methylquinoxalin-2-amine |
|---|---|
| PubChem CID | 106845037 |
| Molecular Formula | C13H16ClN3 |
| Molecular Weight | 249.75 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | N-(4-chlorobutyl)-3-methylquinoxalin-2-amine |
| SMILES | Cc1nc2ccccc2nc1NCCCCCl |
| InChI | InChI=1S/C13H16ClN3/c1-10-13(15-9-5-4-8-14)17-12-7-3-2-6-11(12)16-10/h2-3,6-7H,4-5,8-9H2,1H3,(H,15,17) |
| InChIKey | JBCDDETVXIRCCW-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.75 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|