C17H24N2O — CID 129433141
(2R)-N-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]-2-phenylpropan-1-amine (PubChem CID 129433141) has the molecular formula C17H24N2O and a molecular weight of 272.39 g/mol. Its IUPAC name is (2R)-N-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]-2-phenylpropan-1-amine.
| Compound Name | (2R)-N-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]-2-phenylpropan-1-amine |
|---|---|
| PubChem CID | 129433141 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | (2R)-N-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]-2-phenylpropan-1-amine |
| SMILES | Cc1noc(C)c1CCCNC[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C17H24N2O/c1-13(16-8-5-4-6-9-16)12-18-11-7-10-17-14(2)19-20-15(17)3/h4-6,8-9,13,18H,7,10-12H2,1-3H3/t13-/m0/s1 |
| InChIKey | JBQYUSYTJOYMLM-ZDUSSCGKSA-N |
| XLogP | 3.62 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|