C13H18N4OS — CID 106311755
3-[2-[(2-aminoquinazolin-4-yl)amino]ethylsulfanyl]propan-1-ol (PubChem CID 106311755) has the molecular formula C13H18N4OS and a molecular weight of 278.38 g/mol. Its IUPAC name is 3-[2-[(2-aminoquinazolin-4-yl)amino]ethylsulfanyl]propan-1-ol.
| Compound Name | 3-[2-[(2-aminoquinazolin-4-yl)amino]ethylsulfanyl]propan-1-ol |
|---|---|
| PubChem CID | 106311755 |
| Molecular Formula | C13H18N4OS |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 3-[2-[(2-aminoquinazolin-4-yl)amino]ethylsulfanyl]propan-1-ol |
| SMILES | Nc1nc(NCCSCCCO)c2ccccc2n1 |
| InChI | InChI=1S/C13H18N4OS/c14-13-16-11-5-2-1-4-10(11)12(17-13)15-6-9-19-8-3-7-18/h1-2,4-5,18H,3,6-9H2,(H3,14,15,16,17) |
| InChIKey | NYZCAJIFABXOLD-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|