C15H20N4OS — CID 106311691
3-[2-[(6-amino-2-phenylpyrimidin-4-yl)amino]ethylsulfanyl]propan-1-ol (PubChem CID 106311691) has the molecular formula C15H20N4OS and a molecular weight of 304.42 g/mol. Its IUPAC name is 3-[2-[(6-amino-2-phenylpyrimidin-4-yl)amino]ethylsulfanyl]propan-1-ol.
| Compound Name | 3-[2-[(6-amino-2-phenylpyrimidin-4-yl)amino]ethylsulfanyl]propan-1-ol |
|---|---|
| PubChem CID | 106311691 |
| Molecular Formula | C15H20N4OS |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 3-[2-[(6-amino-2-phenylpyrimidin-4-yl)amino]ethylsulfanyl]propan-1-ol |
| SMILES | Nc1cc(NCCSCCCO)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C15H20N4OS/c16-13-11-14(17-7-10-21-9-4-8-20)19-15(18-13)12-5-2-1-3-6-12/h1-3,5-6,11,20H,4,7-10H2,(H3,16,17,18,19) |
| InChIKey | HBOZQDJYSHOBKF-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|