C16H22N4O — CID 106163239
5-[(6-amino-2-phenylpyrimidin-4-yl)amino]-2-methylpentan-1-ol (PubChem CID 106163239) has the molecular formula C16H22N4O and a molecular weight of 286.38 g/mol. Its IUPAC name is 5-[(6-amino-2-phenylpyrimidin-4-yl)amino]-2-methylpentan-1-ol.
| Compound Name | 5-[(6-amino-2-phenylpyrimidin-4-yl)amino]-2-methylpentan-1-ol |
|---|---|
| PubChem CID | 106163239 |
| Molecular Formula | C16H22N4O |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | 5-[(6-amino-2-phenylpyrimidin-4-yl)amino]-2-methylpentan-1-ol |
| SMILES | CC(CO)CCCNc1cc(N)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C16H22N4O/c1-12(11-21)6-5-9-18-15-10-14(17)19-16(20-15)13-7-3-2-4-8-13/h2-4,7-8,10,12,21H,5-6,9,11H2,1H3,(H3,17,18,19,20) |
| InChIKey | FPMQLZBBSAEVJE-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|