C10H18N4O — CID 106162981
5-[(6-aminopyrimidin-4-yl)amino]-2-methylpentan-1-ol (PubChem CID 106162981) has the molecular formula C10H18N4O and a molecular weight of 210.28 g/mol. Its IUPAC name is 5-[(6-aminopyrimidin-4-yl)amino]-2-methylpentan-1-ol.
| Compound Name | 5-[(6-aminopyrimidin-4-yl)amino]-2-methylpentan-1-ol |
|---|---|
| PubChem CID | 106162981 |
| Molecular Formula | C10H18N4O |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | 5-[(6-aminopyrimidin-4-yl)amino]-2-methylpentan-1-ol |
| SMILES | CC(CO)CCCNc1cc(N)ncn1 |
| InChI | InChI=1S/C10H18N4O/c1-8(6-15)3-2-4-12-10-5-9(11)13-7-14-10/h5,7-8,15H,2-4,6H2,1H3,(H3,11,12,13,14) |
| InChIKey | CHIZCSNAJWGJPT-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|