C11H18BrN3O — CID 106154564
5-[(3-amino-5-bromo-2-pyridinyl)amino]-2-methylpentan-1-ol (PubChem CID 106154564) has the molecular formula C11H18BrN3O and a molecular weight of 288.19 g/mol. Its IUPAC name is 5-[(3-amino-5-bromo-2-pyridinyl)amino]-2-methylpentan-1-ol.
| Compound Name | 5-[(3-amino-5-bromo-2-pyridinyl)amino]-2-methylpentan-1-ol |
|---|---|
| PubChem CID | 106154564 |
| Molecular Formula | C11H18BrN3O |
| Molecular Weight | 288.19 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | 5-[(3-amino-5-bromo-2-pyridinyl)amino]-2-methylpentan-1-ol |
| SMILES | CC(CO)CCCNc1ncc(Br)cc1N |
| InChI | InChI=1S/C11H18BrN3O/c1-8(7-16)3-2-4-14-11-10(13)5-9(12)6-15-11/h5-6,8,16H,2-4,7,13H2,1H3,(H,14,15) |
| InChIKey | CSDTYWHCMFRGON-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.19 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|