C8H13BrN4O2S — CID 61228086
N-[2-[(3-amino-5-bromo-2-pyridinyl)amino]ethyl]methanesulfonamide (PubChem CID 61228086) has the molecular formula C8H13BrN4O2S and a molecular weight of 309.19 g/mol. Its IUPAC name is N-[2-[(3-amino-5-bromo-2-pyridinyl)amino]ethyl]methanesulfonamide.
| Compound Name | N-[2-[(3-amino-5-bromo-2-pyridinyl)amino]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 61228086 |
| Molecular Formula | C8H13BrN4O2S |
| Molecular Weight | 309.19 g/mol |
| Exact Mass | 307.99 |
| IUPAC Name | N-[2-[(3-amino-5-bromo-2-pyridinyl)amino]ethyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCCNc1ncc(Br)cc1N |
| InChI | InChI=1S/C8H13BrN4O2S/c1-16(14,15)13-3-2-11-8-7(10)4-6(9)5-12-8/h4-5,13H,2-3,10H2,1H3,(H,11,12) |
| InChIKey | QMIFNECVZAVBBA-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.19 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|