C8H13N5O — CID 79006981
N-[2-[(6-aminopyrimidin-4-yl)amino]ethyl]acetamide (PubChem CID 79006981) has the molecular formula C8H13N5O and a molecular weight of 195.23 g/mol. Its IUPAC name is N-[2-[(6-aminopyrimidin-4-yl)amino]ethyl]acetamide.
| Compound Name | N-[2-[(6-aminopyrimidin-4-yl)amino]ethyl]acetamide |
|---|---|
| PubChem CID | 79006981 |
| Molecular Formula | C8H13N5O |
| Molecular Weight | 195.23 g/mol |
| Exact Mass | 195.11 |
| IUPAC Name | N-[2-[(6-aminopyrimidin-4-yl)amino]ethyl]acetamide |
| SMILES | CC(=O)NCCNc1cc(N)ncn1 |
| InChI | InChI=1S/C8H13N5O/c1-6(14)10-2-3-11-8-4-7(9)12-5-13-8/h4-5H,2-3H2,1H3,(H,10,14)(H3,9,11,12,13) |
| InChIKey | ROELRDIEKHIQRQ-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.23 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|