C7H11N5O2 — CID 83215450
2-[(6-aminopyrimidin-4-yl)amino]ethyl carbamate (PubChem CID 83215450) has the molecular formula C7H11N5O2 and a molecular weight of 197.20 g/mol. Its IUPAC name is 2-[(6-aminopyrimidin-4-yl)amino]ethyl carbamate.
| Compound Name | 2-[(6-aminopyrimidin-4-yl)amino]ethyl carbamate |
|---|---|
| PubChem CID | 83215450 |
| Molecular Formula | C7H11N5O2 |
| Molecular Weight | 197.20 g/mol |
| Exact Mass | 197.09 |
| IUPAC Name | 2-[(6-aminopyrimidin-4-yl)amino]ethyl carbamate |
| SMILES | NC(=O)OCCNc1cc(N)ncn1 |
| InChI | InChI=1S/C7H11N5O2/c8-5-3-6(12-4-11-5)10-1-2-14-7(9)13/h3-4H,1-2H2,(H2,9,13)(H3,8,10,11,12) |
| InChIKey | RBELVXQDWIKXFS-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 116.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.20 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|