C8H11ClN4O2 — CID 83203473
2-[(6-chloro-2-methylpyrimidin-4-yl)amino]ethyl carbamate (PubChem CID 83203473) has the molecular formula C8H11ClN4O2 and a molecular weight of 230.66 g/mol. Its IUPAC name is 2-[(6-chloro-2-methylpyrimidin-4-yl)amino]ethyl carbamate.
| Compound Name | 2-[(6-chloro-2-methylpyrimidin-4-yl)amino]ethyl carbamate |
|---|---|
| PubChem CID | 83203473 |
| Molecular Formula | C8H11ClN4O2 |
| Molecular Weight | 230.66 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | 2-[(6-chloro-2-methylpyrimidin-4-yl)amino]ethyl carbamate |
| SMILES | Cc1nc(Cl)cc(NCCOC(N)=O)n1 |
| InChI | InChI=1S/C8H11ClN4O2/c1-5-12-6(9)4-7(13-5)11-2-3-15-8(10)14/h4H,2-3H2,1H3,(H2,10,14)(H,11,12,13) |
| InChIKey | LNNUVCNHNRQUHD-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.66 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|