C10H12N4O2 — CID 114766558
2-[(4-cyano-6-methyl-2-pyridinyl)amino]ethyl carbamate (PubChem CID 114766558) has the molecular formula C10H12N4O2 and a molecular weight of 220.23 g/mol. Its IUPAC name is 2-[(4-cyano-6-methyl-2-pyridinyl)amino]ethyl carbamate.
| Compound Name | 2-[(4-cyano-6-methyl-2-pyridinyl)amino]ethyl carbamate |
|---|---|
| PubChem CID | 114766558 |
| Molecular Formula | C10H12N4O2 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | 2-[(4-cyano-6-methyl-2-pyridinyl)amino]ethyl carbamate |
| SMILES | Cc1cc(C#N)cc(NCCOC(N)=O)n1 |
| InChI | InChI=1S/C10H12N4O2/c1-7-4-8(6-11)5-9(14-7)13-2-3-16-10(12)15/h4-5H,2-3H2,1H3,(H2,12,15)(H,13,14) |
| InChIKey | RMRNIBGQIZEXMV-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 101.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|