C10H11ClN4O2 — CID 106240014
2-[2-[(6-chloro-4-cyano-2-pyridinyl)amino]ethoxy]acetamide (PubChem CID 106240014) has the molecular formula C10H11ClN4O2 and a molecular weight of 254.68 g/mol. Its IUPAC name is 2-[2-[(6-chloro-4-cyano-2-pyridinyl)amino]ethoxy]acetamide.
| Compound Name | 2-[2-[(6-chloro-4-cyano-2-pyridinyl)amino]ethoxy]acetamide |
|---|---|
| PubChem CID | 106240014 |
| Molecular Formula | C10H11ClN4O2 |
| Molecular Weight | 254.68 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | 2-[2-[(6-chloro-4-cyano-2-pyridinyl)amino]ethoxy]acetamide |
| SMILES | N#Cc1cc(Cl)nc(NCCOCC(N)=O)c1 |
| InChI | InChI=1S/C10H11ClN4O2/c11-8-3-7(5-12)4-10(15-8)14-1-2-17-6-9(13)16/h3-4H,1-2,6H2,(H2,13,16)(H,14,15) |
| InChIKey | LCJUDJSPXBAHRH-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 101.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.68 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|