C10H10ClN3O2 — CID 83074601
ethyl 2-[(6-chloro-4-cyano-2-pyridinyl)amino]acetate (PubChem CID 83074601) has the molecular formula C10H10ClN3O2 and a molecular weight of 239.66 g/mol. Its IUPAC name is ethyl 2-[(6-chloro-4-cyano-2-pyridinyl)amino]acetate.
| Compound Name | ethyl 2-[(6-chloro-4-cyano-2-pyridinyl)amino]acetate |
|---|---|
| PubChem CID | 83074601 |
| Molecular Formula | C10H10ClN3O2 |
| Molecular Weight | 239.66 g/mol |
| Exact Mass | 239.05 |
| IUPAC Name | ethyl 2-[(6-chloro-4-cyano-2-pyridinyl)amino]acetate |
| SMILES | CCOC(=O)CNc1cc(C#N)cc(Cl)n1 |
| InChI | InChI=1S/C10H10ClN3O2/c1-2-16-10(15)6-13-9-4-7(5-12)3-8(11)14-9/h3-4H,2,6H2,1H3,(H,13,14) |
| InChIKey | SIXVSSPMSUJDEQ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.66 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|