C10H10ClN3 — CID 106196714
2-chloro-6-(2-methylprop-2-enylamino)pyridine-4-carbonitrile (PubChem CID 106196714) has the molecular formula C10H10ClN3 and a molecular weight of 207.66 g/mol. Its IUPAC name is 2-chloro-6-(2-methylprop-2-enylamino)pyridine-4-carbonitrile.
| Compound Name | 2-chloro-6-(2-methylprop-2-enylamino)pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 106196714 |
| Molecular Formula | C10H10ClN3 |
| Molecular Weight | 207.66 g/mol |
| Exact Mass | 207.06 |
| IUPAC Name | 2-chloro-6-(2-methylprop-2-enylamino)pyridine-4-carbonitrile |
| SMILES | C=C(C)CNc1cc(C#N)cc(Cl)n1 |
| InChI | InChI=1S/C10H10ClN3/c1-7(2)6-13-10-4-8(5-12)3-9(11)14-10/h3-4H,1,6H2,2H3,(H,13,14) |
| InChIKey | BOVPILJKNUFTDL-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.66 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|