C10H11ClN2O2 — CID 114617465
2-chloro-6-(2-methylprop-2-enylamino)pyridine-4-carboxylic acid (PubChem CID 114617465) has the molecular formula C10H11ClN2O2 and a molecular weight of 226.66 g/mol. Its IUPAC name is 2-chloro-6-(2-methylprop-2-enylamino)pyridine-4-carboxylic acid.
| Compound Name | 2-chloro-6-(2-methylprop-2-enylamino)pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 114617465 |
| Molecular Formula | C10H11ClN2O2 |
| Molecular Weight | 226.66 g/mol |
| Exact Mass | 226.05 |
| IUPAC Name | 2-chloro-6-(2-methylprop-2-enylamino)pyridine-4-carboxylic acid |
| SMILES | C=C(C)CNc1cc(C(=O)O)cc(Cl)n1 |
| InChI | InChI=1S/C10H11ClN2O2/c1-6(2)5-12-9-4-7(10(14)15)3-8(11)13-9/h3-4H,1,5H2,2H3,(H,12,13)(H,14,15) |
| InChIKey | SXWQHOXIXFJOPX-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.66 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|