C14H21ClN2O2 — CID 63538354
2-chloro-6-(2,4,4-trimethylpentan-2-ylamino)pyridine-4-carboxylic acid (PubChem CID 63538354) has the molecular formula C14H21ClN2O2 and a molecular weight of 284.79 g/mol. Its IUPAC name is 2-chloro-6-(2,4,4-trimethylpentan-2-ylamino)pyridine-4-carboxylic acid.
| Compound Name | 2-chloro-6-(2,4,4-trimethylpentan-2-ylamino)pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 63538354 |
| Molecular Formula | C14H21ClN2O2 |
| Molecular Weight | 284.79 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 2-chloro-6-(2,4,4-trimethylpentan-2-ylamino)pyridine-4-carboxylic acid |
| SMILES | CC(C)(C)CC(C)(C)Nc1cc(C(=O)O)cc(Cl)n1 |
| InChI | InChI=1S/C14H21ClN2O2/c1-13(2,3)8-14(4,5)17-11-7-9(12(18)19)6-10(15)16-11/h6-7H,8H2,1-5H3,(H,16,17)(H,18,19) |
| InChIKey | PRCJEFZIEIDZOF-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.79 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|