C9H10ClN3O3 — CID 43553797
2-[(3-amino-3-oxopropyl)amino]-6-chloropyridine-4-carboxylic acid (PubChem CID 43553797) has the molecular formula C9H10ClN3O3 and a molecular weight of 243.65 g/mol. Its IUPAC name is 2-[(3-amino-3-oxopropyl)amino]-6-chloropyridine-4-carboxylic acid.
| Compound Name | 2-[(3-amino-3-oxopropyl)amino]-6-chloropyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 43553797 |
| Molecular Formula | C9H10ClN3O3 |
| Molecular Weight | 243.65 g/mol |
| Exact Mass | 243.04 |
| IUPAC Name | 2-[(3-amino-3-oxopropyl)amino]-6-chloropyridine-4-carboxylic acid |
| SMILES | NC(=O)CCNc1cc(C(=O)O)cc(Cl)n1 |
| InChI | InChI=1S/C9H10ClN3O3/c10-6-3-5(9(15)16)4-8(13-6)12-2-1-7(11)14/h3-4H,1-2H2,(H2,11,14)(H,12,13)(H,15,16) |
| InChIKey | WTMVBAVXSZIDMX-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.65 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|