C8H11ClN4OS — CID 80545317
3-[(6-chloro-2-methylsulfanylpyrimidin-4-yl)amino]propanamide (PubChem CID 80545317) has the molecular formula C8H11ClN4OS and a molecular weight of 246.72 g/mol. Its IUPAC name is 3-[(6-chloro-2-methylsulfanylpyrimidin-4-yl)amino]propanamide.
| Compound Name | 3-[(6-chloro-2-methylsulfanylpyrimidin-4-yl)amino]propanamide |
|---|---|
| PubChem CID | 80545317 |
| Molecular Formula | C8H11ClN4OS |
| Molecular Weight | 246.72 g/mol |
| Exact Mass | 246.03 |
| IUPAC Name | 3-[(6-chloro-2-methylsulfanylpyrimidin-4-yl)amino]propanamide |
| SMILES | CSc1nc(Cl)cc(NCCC(N)=O)n1 |
| InChI | InChI=1S/C8H11ClN4OS/c1-15-8-12-5(9)4-7(13-8)11-3-2-6(10)14/h4H,2-3H2,1H3,(H2,10,14)(H,11,12,13) |
| InChIKey | GQARJROFIVRBPL-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.72 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |