C8H13ClN4O2S2 — CID 80545291
N-[2-[(6-chloro-2-methylsulfanylpyrimidin-4-yl)amino]ethyl]methanesulfonamide (PubChem CID 80545291) has the molecular formula C8H13ClN4O2S2 and a molecular weight of 296.81 g/mol. Its IUPAC name is N-[2-[(6-chloro-2-methylsulfanylpyrimidin-4-yl)amino]ethyl]methanesulfonamide.
| Compound Name | N-[2-[(6-chloro-2-methylsulfanylpyrimidin-4-yl)amino]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 80545291 |
| Molecular Formula | C8H13ClN4O2S2 |
| Molecular Weight | 296.81 g/mol |
| Exact Mass | 296.02 |
| IUPAC Name | N-[2-[(6-chloro-2-methylsulfanylpyrimidin-4-yl)amino]ethyl]methanesulfonamide |
| SMILES | CSc1nc(Cl)cc(NCCNS(C)(=O)=O)n1 |
| InChI | InChI=1S/C8H13ClN4O2S2/c1-16-8-12-6(9)5-7(13-8)10-3-4-11-17(2,14)15/h5,11H,3-4H2,1-2H3,(H,10,12,13) |
| InChIKey | ZXHRSZQKMKRUJR-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.81 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|