C10H16ClN3OS2 — CID 106311324
3-[2-[(6-chloro-2-methylsulfanylpyrimidin-4-yl)amino]ethylsulfanyl]propan-1-ol (PubChem CID 106311324) has the molecular formula C10H16ClN3OS2 and a molecular weight of 293.85 g/mol. Its IUPAC name is 3-[2-[(6-chloro-2-methylsulfanylpyrimidin-4-yl)amino]ethylsulfanyl]propan-1-ol.
| Compound Name | 3-[2-[(6-chloro-2-methylsulfanylpyrimidin-4-yl)amino]ethylsulfanyl]propan-1-ol |
|---|---|
| PubChem CID | 106311324 |
| Molecular Formula | C10H16ClN3OS2 |
| Molecular Weight | 293.85 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | 3-[2-[(6-chloro-2-methylsulfanylpyrimidin-4-yl)amino]ethylsulfanyl]propan-1-ol |
| SMILES | CSc1nc(Cl)cc(NCCSCCCO)n1 |
| InChI | InChI=1S/C10H16ClN3OS2/c1-16-10-13-8(11)7-9(14-10)12-3-6-17-5-2-4-15/h7,15H,2-6H2,1H3,(H,12,13,14) |
| InChIKey | NQKRCJXFRGDANA-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.85 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|