C13H14ClN3O2S2 — CID 80542468
6-chloro-2-methylsulfanyl-N-[(4-methylsulfonylphenyl)methyl]pyrimidin-4-amine (PubChem CID 80542468) has the molecular formula C13H14ClN3O2S2 and a molecular weight of 343.86 g/mol. Its IUPAC name is 6-chloro-2-methylsulfanyl-N-[(4-methylsulfonylphenyl)methyl]pyrimidin-4-amine.
| Compound Name | 6-chloro-2-methylsulfanyl-N-[(4-methylsulfonylphenyl)methyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 80542468 |
| Molecular Formula | C13H14ClN3O2S2 |
| Molecular Weight | 343.86 g/mol |
| Exact Mass | 343.02 |
| IUPAC Name | 6-chloro-2-methylsulfanyl-N-[(4-methylsulfonylphenyl)methyl]pyrimidin-4-amine |
| SMILES | CSc1nc(Cl)cc(NCc2ccc(S(C)(=O)=O)cc2)n1 |
| InChI | InChI=1S/C13H14ClN3O2S2/c1-20-13-16-11(14)7-12(17-13)15-8-9-3-5-10(6-4-9)21(2,18)19/h3-7H,8H2,1-2H3,(H,15,16,17) |
| InChIKey | OXLJNVKZLMCYIJ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.86 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |