C13H11ClN4S — CID 80546842
3-[[(6-chloro-2-methylsulfanylpyrimidin-4-yl)amino]methyl]benzonitrile (PubChem CID 80546842) has the molecular formula C13H11ClN4S and a molecular weight of 290.78 g/mol. Its IUPAC name is 3-[[(6-chloro-2-methylsulfanylpyrimidin-4-yl)amino]methyl]benzonitrile.
| Compound Name | 3-[[(6-chloro-2-methylsulfanylpyrimidin-4-yl)amino]methyl]benzonitrile |
|---|---|
| PubChem CID | 80546842 |
| Molecular Formula | C13H11ClN4S |
| Molecular Weight | 290.78 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | 3-[[(6-chloro-2-methylsulfanylpyrimidin-4-yl)amino]methyl]benzonitrile |
| SMILES | CSc1nc(Cl)cc(NCc2cccc(C#N)c2)n1 |
| InChI | InChI=1S/C13H11ClN4S/c1-19-13-17-11(14)6-12(18-13)16-8-10-4-2-3-9(5-10)7-15/h2-6H,8H2,1H3,(H,16,17,18) |
| InChIKey | UHZIHJDFCPQZBO-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.78 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |