C14H12BrN3 — CID 113352961
3-[[(5-bromo-4-methyl-2-pyridinyl)amino]methyl]benzonitrile (PubChem CID 113352961) has the molecular formula C14H12BrN3 and a molecular weight of 302.18 g/mol. Its IUPAC name is 3-[[(5-bromo-4-methyl-2-pyridinyl)amino]methyl]benzonitrile.
| Compound Name | 3-[[(5-bromo-4-methyl-2-pyridinyl)amino]methyl]benzonitrile |
|---|---|
| PubChem CID | 113352961 |
| Molecular Formula | C14H12BrN3 |
| Molecular Weight | 302.18 g/mol |
| Exact Mass | 301.02 |
| IUPAC Name | 3-[[(5-bromo-4-methyl-2-pyridinyl)amino]methyl]benzonitrile |
| SMILES | Cc1cc(NCc2cccc(C#N)c2)ncc1Br |
| InChI | InChI=1S/C14H12BrN3/c1-10-5-14(18-9-13(10)15)17-8-12-4-2-3-11(6-12)7-16/h2-6,9H,8H2,1H3,(H,17,18) |
| InChIKey | YULHQEHLNZOVAO-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.18 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |