C11H13BrN4 — CID 115773970
5-bromo-4-methyl-N-[(1-methylpyrazol-4-yl)methyl]pyridin-2-amine (PubChem CID 115773970) has the molecular formula C11H13BrN4 and a molecular weight of 281.16 g/mol. Its IUPAC name is 5-bromo-4-methyl-N-[(1-methylpyrazol-4-yl)methyl]pyridin-2-amine.
| Compound Name | 5-bromo-4-methyl-N-[(1-methylpyrazol-4-yl)methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 115773970 |
| Molecular Formula | C11H13BrN4 |
| Molecular Weight | 281.16 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | 5-bromo-4-methyl-N-[(1-methylpyrazol-4-yl)methyl]pyridin-2-amine |
| SMILES | Cc1cc(NCc2cnn(C)c2)ncc1Br |
| InChI | InChI=1S/C11H13BrN4/c1-8-3-11(14-6-10(8)12)13-4-9-5-15-16(2)7-9/h3,5-7H,4H2,1-2H3,(H,13,14) |
| InChIKey | MTWNIQXVKZYBSN-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.16 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |