About 6-N-methyl-4-N-[(1-methylpyrazol-4-yl)methyl]pyrimidine-4,6-diamine
6-N-methyl-4-N-[(1-methylpyrazol-4-yl)methyl]pyrimidine-4,6-diamine (PubChem CID 80817082) has the molecular formula C10H14N6
and a molecular weight of 218.26 g/mol. Its IUPAC name is 6-N-methyl-4-N-[(1-methylpyrazol-4-yl)methyl]pyrimidine-4,6-diamine.
Molecular Properties
| Compound Name | 6-N-methyl-4-N-[(1-methylpyrazol-4-yl)methyl]pyrimidine-4,6-diamine |
| PubChem CID | 80817082 |
| Molecular Formula | C10H14N6 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 6-N-methyl-4-N-[(1-methylpyrazol-4-yl)methyl]pyrimidine-4,6-diamine |
| SMILES | CNc1cc(NCc2cnn(C)c2)ncn1 |
| InChI | InChI=1S/C10H14N6/c1-11-9-3-10(14-7-13-9)12-4-8-5-15-16(2)6-8/h3,5-7H,4H2,1-2H3,(H2,11,12,13,14) |
| InChIKey | QVSJKTKTZXRIOA-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 67.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-N-methyl-4-N-[(1-methylpyrazol-4-yl)methyl]pyrimidine-4,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-N-methyl-4-N-[(1-methylpyrazol-4-yl)methyl]pyrimidine-4,6-diamine?
The IUPAC name of 6-N-methyl-4-N-[(1-methylpyrazol-4-yl)methyl]pyrimidine-4,6-diamine (CID 80817082) is 6-N-methyl-4-N-[(1-methylpyrazol-4-yl)methyl]pyrimidine-4,6-diamine.
What is the SMILES notation for 6-N-methyl-4-N-[(1-methylpyrazol-4-yl)methyl]pyrimidine-4,6-diamine?
The canonical SMILES for 6-N-methyl-4-N-[(1-methylpyrazol-4-yl)methyl]pyrimidine-4,6-diamine is CNc1cc(NCc2cnn(C)c2)ncn1.
What is the InChIKey of 6-N-methyl-4-N-[(1-methylpyrazol-4-yl)methyl]pyrimidine-4,6-diamine?
The InChIKey is QVSJKTKTZXRIOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N6/c1-11-9-3-10(14-7-13-9)12-4-8-5-15-16(2)6-8/h3,5-7H,4H2,1-2H3,(H2,11,12,13,14).
What are the key properties of 6-N-methyl-4-N-[(1-methylpyrazol-4-yl)methyl]pyrimidine-4,6-diamine?
6-N-methyl-4-N-[(1-methylpyrazol-4-yl)methyl]pyrimidine-4,6-diamine has a molecular weight of 218.26 g/mol, XLogP of 0.86, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-N-methyl-4-N-[(1-methylpyrazol-4-yl)methyl]pyrimidine-4,6-diamine is sourced from PubChem (CID 80817082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).