C14H9Br3N2 — CID 28991857
3-[(2,4,6-tribromoanilino)methyl]benzonitrile (PubChem CID 28991857) has the molecular formula C14H9Br3N2 and a molecular weight of 444.95 g/mol. Its IUPAC name is 3-[(2,4,6-tribromoanilino)methyl]benzonitrile.
| Compound Name | 3-[(2,4,6-tribromoanilino)methyl]benzonitrile |
|---|---|
| PubChem CID | 28991857 |
| Molecular Formula | C14H9Br3N2 |
| Molecular Weight | 444.95 g/mol |
| Exact Mass | 441.83 |
| IUPAC Name | 3-[(2,4,6-tribromoanilino)methyl]benzonitrile |
| SMILES | N#Cc1cccc(CNc2c(Br)cc(Br)cc2Br)c1 |
| InChI | InChI=1S/C14H9Br3N2/c15-11-5-12(16)14(13(17)6-11)19-8-10-3-1-2-9(4-10)7-18/h1-6,19H,8H2 |
| InChIKey | TUFCKWFCAKHMKN-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.95 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |