C18H22N4 — CID 133409283
3-[[[2,6-di(propan-2-yl)pyrimidin-4-yl]amino]methyl]benzonitrile (PubChem CID 133409283) has the molecular formula C18H22N4 and a molecular weight of 294.40 g/mol. Its IUPAC name is 3-[[[2,6-di(propan-2-yl)pyrimidin-4-yl]amino]methyl]benzonitrile.
| Compound Name | 3-[[[2,6-di(propan-2-yl)pyrimidin-4-yl]amino]methyl]benzonitrile |
|---|---|
| PubChem CID | 133409283 |
| Molecular Formula | C18H22N4 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | 3-[[[2,6-di(propan-2-yl)pyrimidin-4-yl]amino]methyl]benzonitrile |
| SMILES | CC(C)c1cc(NCc2cccc(C#N)c2)nc(C(C)C)n1 |
| InChI | InChI=1S/C18H22N4/c1-12(2)16-9-17(22-18(21-16)13(3)4)20-11-15-7-5-6-14(8-15)10-19/h5-9,12-13H,11H2,1-4H3,(H,20,21,22) |
| InChIKey | KPAXVAUCLYVLAJ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |