C13H11Cl2N3OS — CID 91040644
S-[4-chloro-6-[(4-chlorophenyl)methylamino]pyrimidin-2-yl] ethanethioate (PubChem CID 91040644) has the molecular formula C13H11Cl2N3OS and a molecular weight of 328.22 g/mol. Its IUPAC name is S-[4-chloro-6-[(4-chlorophenyl)methylamino]pyrimidin-2-yl] ethanethioate.
| Compound Name | S-[4-chloro-6-[(4-chlorophenyl)methylamino]pyrimidin-2-yl] ethanethioate |
|---|---|
| PubChem CID | 91040644 |
| Molecular Formula | C13H11Cl2N3OS |
| Molecular Weight | 328.22 g/mol |
| Exact Mass | 327.00 |
| IUPAC Name | S-[4-chloro-6-[(4-chlorophenyl)methylamino]pyrimidin-2-yl] ethanethioate |
| SMILES | CC(=O)Sc1nc(Cl)cc(NCc2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C13H11Cl2N3OS/c1-8(19)20-13-17-11(15)6-12(18-13)16-7-9-2-4-10(14)5-3-9/h2-6H,7H2,1H3,(H,16,17,18) |
| InChIKey | WYMQETMNTPLRQR-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.22 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|