C12H11ClN4O2 — CID 18388121
4-[[(2-amino-6-chloropyrimidin-4-yl)amino]methyl]benzoic acid (PubChem CID 18388121) has the molecular formula C12H11ClN4O2 and a molecular weight of 278.70 g/mol. Its IUPAC name is 4-[[(2-amino-6-chloropyrimidin-4-yl)amino]methyl]benzoic acid.
| Compound Name | 4-[[(2-amino-6-chloropyrimidin-4-yl)amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 18388121 |
| Molecular Formula | C12H11ClN4O2 |
| Molecular Weight | 278.70 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | 4-[[(2-amino-6-chloropyrimidin-4-yl)amino]methyl]benzoic acid |
| SMILES | Nc1nc(Cl)cc(NCc2ccc(C(=O)O)cc2)n1 |
| InChI | InChI=1S/C12H11ClN4O2/c13-9-5-10(17-12(14)16-9)15-6-7-1-3-8(4-2-7)11(18)19/h1-5H,6H2,(H,18,19)(H3,14,15,16,17) |
| InChIKey | MKAQGKJSMPLJND-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 101.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.70 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |