C14H10ClN3O2 — CID 62268789
2-chloro-6-[(4-cyanophenyl)methylamino]pyridine-4-carboxylic acid (PubChem CID 62268789) has the molecular formula C14H10ClN3O2 and a molecular weight of 287.71 g/mol. Its IUPAC name is 2-chloro-6-[(4-cyanophenyl)methylamino]pyridine-4-carboxylic acid.
| Compound Name | 2-chloro-6-[(4-cyanophenyl)methylamino]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 62268789 |
| Molecular Formula | C14H10ClN3O2 |
| Molecular Weight | 287.71 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | 2-chloro-6-[(4-cyanophenyl)methylamino]pyridine-4-carboxylic acid |
| SMILES | N#Cc1ccc(CNc2cc(C(=O)O)cc(Cl)n2)cc1 |
| InChI | InChI=1S/C14H10ClN3O2/c15-12-5-11(14(19)20)6-13(18-12)17-8-10-3-1-9(7-16)2-4-10/h1-6H,8H2,(H,17,18)(H,19,20) |
| InChIKey | KILDQDNBJXMBIC-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 86.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.71 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|