C13H9Cl2N3 — CID 83074582
2-chloro-6-[(4-chlorophenyl)methylamino]pyridine-4-carbonitrile (PubChem CID 83074582) has the molecular formula C13H9Cl2N3 and a molecular weight of 278.14 g/mol. Its IUPAC name is 2-chloro-6-[(4-chlorophenyl)methylamino]pyridine-4-carbonitrile.
| Compound Name | 2-chloro-6-[(4-chlorophenyl)methylamino]pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 83074582 |
| Molecular Formula | C13H9Cl2N3 |
| Molecular Weight | 278.14 g/mol |
| Exact Mass | 277.02 |
| IUPAC Name | 2-chloro-6-[(4-chlorophenyl)methylamino]pyridine-4-carbonitrile |
| SMILES | N#Cc1cc(Cl)nc(NCc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C13H9Cl2N3/c14-11-3-1-9(2-4-11)8-17-13-6-10(7-16)5-12(15)18-13/h1-6H,8H2,(H,17,18) |
| InChIKey | VXJHKYGZESKJDN-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.14 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|