C11H12ClN3S2 — CID 80545855
6-chloro-2-methylsulfanyl-N-[(3-methylthiophen-2-yl)methyl]pyrimidin-4-amine (PubChem CID 80545855) has the molecular formula C11H12ClN3S2 and a molecular weight of 285.83 g/mol. Its IUPAC name is 6-chloro-2-methylsulfanyl-N-[(3-methylthiophen-2-yl)methyl]pyrimidin-4-amine.
| Compound Name | 6-chloro-2-methylsulfanyl-N-[(3-methylthiophen-2-yl)methyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 80545855 |
| Molecular Formula | C11H12ClN3S2 |
| Molecular Weight | 285.83 g/mol |
| Exact Mass | 285.02 |
| IUPAC Name | 6-chloro-2-methylsulfanyl-N-[(3-methylthiophen-2-yl)methyl]pyrimidin-4-amine |
| SMILES | CSc1nc(Cl)cc(NCc2sccc2C)n1 |
| InChI | InChI=1S/C11H12ClN3S2/c1-7-3-4-17-8(7)6-13-10-5-9(12)14-11(15-10)16-2/h3-5H,6H2,1-2H3,(H,13,14,15) |
| InChIKey | XNDZQVXKNSXMRK-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.83 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |