C8H10ClN3O4S — CID 43552562
2-chloro-6-(2-sulfamoylethylamino)pyridine-4-carboxylic acid (PubChem CID 43552562) has the molecular formula C8H10ClN3O4S and a molecular weight of 279.71 g/mol. Its IUPAC name is 2-chloro-6-(2-sulfamoylethylamino)pyridine-4-carboxylic acid.
| Compound Name | 2-chloro-6-(2-sulfamoylethylamino)pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 43552562 |
| Molecular Formula | C8H10ClN3O4S |
| Molecular Weight | 279.71 g/mol |
| Exact Mass | 279.01 |
| IUPAC Name | 2-chloro-6-(2-sulfamoylethylamino)pyridine-4-carboxylic acid |
| SMILES | NS(=O)(=O)CCNc1cc(C(=O)O)cc(Cl)n1 |
| InChI | InChI=1S/C8H10ClN3O4S/c9-6-3-5(8(13)14)4-7(12-6)11-1-2-17(10,15)16/h3-4H,1-2H2,(H,11,12)(H,13,14)(H2,10,15,16) |
| InChIKey | OQOJQGHUBNNDEJ-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 122.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.71 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|