C12H13ClN4O2 — CID 106105316
2-chloro-6-[2-(1-methylpyrazol-3-yl)ethylamino]pyridine-4-carboxylic acid (PubChem CID 106105316) has the molecular formula C12H13ClN4O2 and a molecular weight of 280.72 g/mol. Its IUPAC name is 2-chloro-6-[2-(1-methylpyrazol-3-yl)ethylamino]pyridine-4-carboxylic acid.
| Compound Name | 2-chloro-6-[2-(1-methylpyrazol-3-yl)ethylamino]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 106105316 |
| Molecular Formula | C12H13ClN4O2 |
| Molecular Weight | 280.72 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | 2-chloro-6-[2-(1-methylpyrazol-3-yl)ethylamino]pyridine-4-carboxylic acid |
| SMILES | Cn1ccc(CCNc2cc(C(=O)O)cc(Cl)n2)n1 |
| InChI | InChI=1S/C12H13ClN4O2/c1-17-5-3-9(16-17)2-4-14-11-7-8(12(18)19)6-10(13)15-11/h3,5-7H,2,4H2,1H3,(H,14,15)(H,18,19) |
| InChIKey | KLKPAKHCRMPELE-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.72 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|