C11H11ClN4O3 — CID 114186360
2-chloro-6-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethylamino]pyridine-4-carboxylic acid (PubChem CID 114186360) has the molecular formula C11H11ClN4O3 and a molecular weight of 282.69 g/mol. Its IUPAC name is 2-chloro-6-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethylamino]pyridine-4-carboxylic acid.
| Compound Name | 2-chloro-6-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethylamino]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 114186360 |
| Molecular Formula | C11H11ClN4O3 |
| Molecular Weight | 282.69 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | 2-chloro-6-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethylamino]pyridine-4-carboxylic acid |
| SMILES | Cc1nc(CCNc2cc(C(=O)O)cc(Cl)n2)no1 |
| InChI | InChI=1S/C11H11ClN4O3/c1-6-14-9(16-19-6)2-3-13-10-5-7(11(17)18)4-8(12)15-10/h4-5H,2-3H2,1H3,(H,13,15)(H,17,18) |
| InChIKey | OPOUWAXQXPVOFN-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 101.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.69 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|