C11H11ClN2O2 — CID 106222382
2-chloro-6-(pent-4-ynylamino)pyridine-4-carboxylic acid (PubChem CID 106222382) has the molecular formula C11H11ClN2O2 and a molecular weight of 238.67 g/mol. Its IUPAC name is 2-chloro-6-(pent-4-ynylamino)pyridine-4-carboxylic acid.
| Compound Name | 2-chloro-6-(pent-4-ynylamino)pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 106222382 |
| Molecular Formula | C11H11ClN2O2 |
| Molecular Weight | 238.67 g/mol |
| Exact Mass | 238.05 |
| IUPAC Name | 2-chloro-6-(pent-4-ynylamino)pyridine-4-carboxylic acid |
| SMILES | C#CCCCNc1cc(C(=O)O)cc(Cl)n1 |
| InChI | InChI=1S/C11H11ClN2O2/c1-2-3-4-5-13-10-7-8(11(15)16)6-9(12)14-10/h1,6-7H,3-5H2,(H,13,14)(H,15,16) |
| InChIKey | HSQUKNJMFJEYSU-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.67 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|