C10H13ClN2O2 — CID 21430349
2-(butan-2-ylamino)-6-chloropyridine-4-carboxylic acid (PubChem CID 21430349) has the molecular formula C10H13ClN2O2 and a molecular weight of 228.68 g/mol. Its IUPAC name is 2-(butan-2-ylamino)-6-chloropyridine-4-carboxylic acid.
| Compound Name | 2-(butan-2-ylamino)-6-chloropyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 21430349 |
| Molecular Formula | C10H13ClN2O2 |
| Molecular Weight | 228.68 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | 2-(butan-2-ylamino)-6-chloropyridine-4-carboxylic acid |
| SMILES | CCC(C)Nc1cc(C(=O)O)cc(Cl)n1 |
| InChI | InChI=1S/C10H13ClN2O2/c1-3-6(2)12-9-5-7(10(14)15)4-8(11)13-9/h4-6H,3H2,1-2H3,(H,12,13)(H,14,15) |
| InChIKey | XZHDGLIKPJVXIQ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.68 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|