C11H12ClN3O3 — CID 43568560
2-chloro-6-[[2-(cyclopropylamino)-2-oxoethyl]amino]pyridine-4-carboxylic acid (PubChem CID 43568560) has the molecular formula C11H12ClN3O3 and a molecular weight of 269.69 g/mol. Its IUPAC name is 2-chloro-6-[[2-(cyclopropylamino)-2-oxoethyl]amino]pyridine-4-carboxylic acid.
| Compound Name | 2-chloro-6-[[2-(cyclopropylamino)-2-oxoethyl]amino]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 43568560 |
| Molecular Formula | C11H12ClN3O3 |
| Molecular Weight | 269.69 g/mol |
| Exact Mass | 269.06 |
| IUPAC Name | 2-chloro-6-[[2-(cyclopropylamino)-2-oxoethyl]amino]pyridine-4-carboxylic acid |
| SMILES | O=C(CNc1cc(C(=O)O)cc(Cl)n1)NC1CC1 |
| InChI | InChI=1S/C11H12ClN3O3/c12-8-3-6(11(17)18)4-9(15-8)13-5-10(16)14-7-1-2-7/h3-4,7H,1-2,5H2,(H,13,15)(H,14,16)(H,17,18) |
| InChIKey | KXUCMYUHGWABRJ-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.69 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|