C11H15ClN2O3S — CID 106248046
2-chloro-6-[(2-hydroxy-2-methyl-3-methylsulfanylpropyl)amino]pyridine-4-carboxylic acid (PubChem CID 106248046) has the molecular formula C11H15ClN2O3S and a molecular weight of 290.77 g/mol. Its IUPAC name is 2-chloro-6-[(2-hydroxy-2-methyl-3-methylsulfanylpropyl)amino]pyridine-4-carboxylic acid.
| Compound Name | 2-chloro-6-[(2-hydroxy-2-methyl-3-methylsulfanylpropyl)amino]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 106248046 |
| Molecular Formula | C11H15ClN2O3S |
| Molecular Weight | 290.77 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | 2-chloro-6-[(2-hydroxy-2-methyl-3-methylsulfanylpropyl)amino]pyridine-4-carboxylic acid |
| SMILES | CSCC(C)(O)CNc1cc(C(=O)O)cc(Cl)n1 |
| InChI | InChI=1S/C11H15ClN2O3S/c1-11(17,6-18-2)5-13-9-4-7(10(15)16)3-8(12)14-9/h3-4,17H,5-6H2,1-2H3,(H,13,14)(H,15,16) |
| InChIKey | NPADJVUXLKSYNT-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.77 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|