C9H9ClN4O — CID 83073416
2-[(6-chloro-4-cyano-2-pyridinyl)amino]propanamide (PubChem CID 83073416) has the molecular formula C9H9ClN4O and a molecular weight of 224.65 g/mol. Its IUPAC name is 2-[(6-chloro-4-cyano-2-pyridinyl)amino]propanamide.
| Compound Name | 2-[(6-chloro-4-cyano-2-pyridinyl)amino]propanamide |
|---|---|
| PubChem CID | 83073416 |
| Molecular Formula | C9H9ClN4O |
| Molecular Weight | 224.65 g/mol |
| Exact Mass | 224.05 |
| IUPAC Name | 2-[(6-chloro-4-cyano-2-pyridinyl)amino]propanamide |
| SMILES | CC(Nc1cc(C#N)cc(Cl)n1)C(N)=O |
| InChI | InChI=1S/C9H9ClN4O/c1-5(9(12)15)13-8-3-6(4-11)2-7(10)14-8/h2-3,5H,1H3,(H2,12,15)(H,13,14) |
| InChIKey | HDKQHZKJNVOUOI-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 91.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.65 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|