C12H16ClN3O — CID 106352536
2-chloro-6-[(1-hydroxy-4-methylpentan-3-yl)amino]pyridine-4-carbonitrile (PubChem CID 106352536) has the molecular formula C12H16ClN3O and a molecular weight of 253.73 g/mol. Its IUPAC name is 2-chloro-6-[(1-hydroxy-4-methylpentan-3-yl)amino]pyridine-4-carbonitrile.
| Compound Name | 2-chloro-6-[(1-hydroxy-4-methylpentan-3-yl)amino]pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 106352536 |
| Molecular Formula | C12H16ClN3O |
| Molecular Weight | 253.73 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | 2-chloro-6-[(1-hydroxy-4-methylpentan-3-yl)amino]pyridine-4-carbonitrile |
| SMILES | CC(C)C(CCO)Nc1cc(C#N)cc(Cl)n1 |
| InChI | InChI=1S/C12H16ClN3O/c1-8(2)10(3-4-17)15-12-6-9(7-14)5-11(13)16-12/h5-6,8,10,17H,3-4H2,1-2H3,(H,15,16) |
| InChIKey | KZESRIGAHLWYTM-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 68.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.73 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|