C15H23ClN4 — CID 83073411
2-chloro-6-[5-(diethylamino)pentan-2-ylamino]pyridine-4-carbonitrile (PubChem CID 83073411) has the molecular formula C15H23ClN4 and a molecular weight of 294.83 g/mol. Its IUPAC name is 2-chloro-6-[5-(diethylamino)pentan-2-ylamino]pyridine-4-carbonitrile.
| Compound Name | 2-chloro-6-[5-(diethylamino)pentan-2-ylamino]pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 83073411 |
| Molecular Formula | C15H23ClN4 |
| Molecular Weight | 294.83 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 2-chloro-6-[5-(diethylamino)pentan-2-ylamino]pyridine-4-carbonitrile |
| SMILES | CCN(CC)CCCC(C)Nc1cc(C#N)cc(Cl)n1 |
| InChI | InChI=1S/C15H23ClN4/c1-4-20(5-2)8-6-7-12(3)18-15-10-13(11-17)9-14(16)19-15/h9-10,12H,4-8H2,1-3H3,(H,18,19) |
| InChIKey | AERBWFYSNRXAHN-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 51.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.83 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|