C16H23F2N3 — CID 81285374
4-[5-(diethylamino)pentan-2-ylamino]-3,5-difluorobenzonitrile (PubChem CID 81285374) has the molecular formula C16H23F2N3 and a molecular weight of 295.38 g/mol. Its IUPAC name is 4-[5-(diethylamino)pentan-2-ylamino]-3,5-difluorobenzonitrile.
| Compound Name | 4-[5-(diethylamino)pentan-2-ylamino]-3,5-difluorobenzonitrile |
|---|---|
| PubChem CID | 81285374 |
| Molecular Formula | C16H23F2N3 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | 4-[5-(diethylamino)pentan-2-ylamino]-3,5-difluorobenzonitrile |
| SMILES | CCN(CC)CCCC(C)Nc1c(F)cc(C#N)cc1F |
| InChI | InChI=1S/C16H23F2N3/c1-4-21(5-2)8-6-7-12(3)20-16-14(17)9-13(11-19)10-15(16)18/h9-10,12,20H,4-8H2,1-3H3 |
| InChIKey | VXYCRBNOVWYNMG-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |